ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53619-55-9 4-nitro-7-[(4-nitrophenyl)sulfinyl]-2,1,3-benzoxadiazole 1-oxide |
|
| Chemical Name | 4-nitro-7-[(4-nitrophenyl)sulfinyl]-2,1,3-benzoxadiazole 1-oxide |
| Molecular Formula | C12H6N4O7S |
| Molecular Weight | 350.2636 |
| InChl | InChI=1/C12H6N4O7S/c17-14(18)7-1-3-8(4-2-7)24(22)10-6-5-9(15(19)20)11-12(10)16(21)23-13-11/h1-6H |
| CAS Registry Number | 53619-55-9 |
| Molecular Structure | ![]() |
| Density | 1.95g/cm3 |
| Boiling Point | 644.4°C at 760 mmHg |
| Refractive Index | 1.841 |
| Flash Point | 343.5°C |
| Vapour Pressur | 8.63E-16mmHg at 25°C |
| MSDS | |