ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53859-10-2 4-(4-chlorobenzhydryl)-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]piperazinediylium maleate |
|
| Chemical Name | 4-(4-chlorobenzhydryl)-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]piperazinediylium maleate |
| Synonyms | 4-(4-Chlorobenzhydryl)-1-(2-(2-(2-hydroxyethoxy)ethoxy)ethyl)piperazinediylium maleate;2-[2-(2-{4-[(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}ethoxy)ethoxy]ethanol but-2-enedioate (1:1);2-[2-(2-{4-[(4'-chlorobiphenyl-4-yl)methyl]piperazin-1-yl}ethoxy)ethoxy]ethanol (2Z)-but-2-enedioate (salt) |
| Molecular Formula | C27H35ClN2O7 |
| Molecular Weight | 535.029 |
| InChl | InChI=1/C23H31ClN2O3.C4H4O4/c24-23-7-5-22(6-8-23)21-3-1-20(2-4-21)19-26-11-9-25(10-12-26)13-15-28-17-18-29-16-14-27;5-3(6)1-2-4(7)8/h1-8,27H,9-19H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| CAS Registry Number | 53859-10-2 |
| EINECS | 258-823-8 |
| Molecular Structure | ![]() |
| Boiling Point | 558.3°C at 760 mmHg |
| Flash Point | 291.4°C |
| Vapour Pressur | 2.67E-13mmHg at 25°C |
| MSDS | |