ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54211-46-0 4''-pentyl-p-terphenyl-4-carbonitrile |
|
| Chemical Name | 4''-pentyl-p-terphenyl-4-carbonitrile |
| Synonyms | (1,1':4',1''-Terphenyl)-4-carbonitrile, 4''-pentyl-;[1,1':4',1''-terphenyl]-4-carbonitrile, 4''-pentyl-;4''-Pentyl-1,1':4',1''-terphenyl-4-carbonitrile;4-Cyano-4-n-Pentyl-p-Cphenyl;4-[4-(4-pentylphenyl)phenyl]benzonitrile;4''-Pentyl-[1,1':4',1''-Terphenyl]-4-Carbonitrile;4-Cyano-4'-Pentylterphenyl |
| Molecular Formula | C24H23N |
| Molecular Weight | 325.4461 |
| InChl | InChI=1/C24H23N/c1-2-3-4-5-19-6-10-21(11-7-19)23-14-16-24(17-15-23)22-12-8-20(18-25)9-13-22/h6-17H,2-5H2,1H3 |
| CAS Registry Number | 54211-46-0 |
| EINECS | 259-028-9 |
| Molecular Structure | ![]() |
| Density | 1.08g/cm3 |
| Boiling Point | 508.7°C at 760 mmHg |
| Refractive Index | 1.608 |
| Flash Point | 263.6°C |
| Vapour Pressur | 1.81E-10mmHg at 25°C |
| MSDS | |