ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54963-63-2 4-(hexyloxy)phenyl 4-(octyloxy)benzoate |
|
| Chemical Name | 4-(hexyloxy)phenyl 4-(octyloxy)benzoate |
| Synonyms | 4-(Hexyloxy)phenyl 4-(octyloxy)benzoate;benzoic acid, 4-(octyloxy)-, 4-(hexyloxy)phenyl ester |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.5882 |
| InChl | InChI=1/C27H38O4/c1-3-5-7-9-10-12-22-29-24-15-13-23(14-16-24)27(28)31-26-19-17-25(18-20-26)30-21-11-8-6-4-2/h13-20H,3-12,21-22H2,1-2H3 |
| CAS Registry Number | 54963-63-2 |
| Molecular Structure | ![]() |
| Density | 1.018g/cm3 |
| Boiling Point | 545.025°C at 760 mmHg |
| Refractive Index | 1.518 |
| Flash Point | 230.649°C |
| Vapour Pressur | 0mmHg at 25°C |
| MSDS | |