ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55911-95-0 carbamic acid, compound with propylenediamine |
|
| Chemical Name | carbamic acid, compound with propylenediamine |
| Synonyms | Carbamic acid, compd. with 1,2-propanediamine (1:?);1,2-Propylenediamine carbamate;Carbamic acid, compd. with 1,2-propanediamine;Carbamic acid, compound with propylenediamine;carbamic acid - propane-1,2-diamine (1:1) |
| Molecular Formula | C4H13N3O2 |
| Molecular Weight | 135.1649 |
| InChl | InChI=1/C3H10N2.CH3NO2/c1-3(5)2-4;2-1(3)4/h3H,2,4-5H2,1H3;2H2,(H,3,4) |
| CAS Registry Number | 55911-95-0 |
| EINECS | 259-896-9 |
| Molecular Structure | ![]() |
| Boiling Point | 117.3°C at 760 mmHg |
| Flash Point | 33.3°C |
| Vapour Pressur | 17.5mmHg at 25°C |
| MSDS | |