ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57278-27-0 4-amino-5-(4-aminophenyl)-1-[3-(3-methylphenoxy)propyl]pyrimidin-2(1H)-one |
|
| Chemical Name | 4-amino-5-(4-aminophenyl)-1-[3-(3-methylphenoxy)propyl]pyrimidin-2(1H)-one |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.4143 |
| InChl | InChI=1/C20H22N4O2/c1-14-4-2-5-17(12-14)26-11-3-10-24-13-18(19(22)23-20(24)25)15-6-8-16(21)9-7-15/h2,4-9,12-13H,3,10-11,21H2,1H3,(H2,22,23,25) |
| CAS Registry Number | 57278-27-0 |
| Molecular Structure | ![]() |
| Density | 1.24g/cm3 |
| Boiling Point | 592.7°C at 760 mmHg |
| Refractive Index | 1.63 |
| Flash Point | 312.3°C |
| Vapour Pressur | 5.07E-14mmHg at 25°C |
| MSDS | |