ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57645-77-9 4-amino-5-chloro-N-[1-(diphenylmethyl)piperidin-4-yl]-2-methoxybenzamide hydrochloride |
|
| Chemical Name | 4-amino-5-chloro-N-[1-(diphenylmethyl)piperidin-4-yl]-2-methoxybenzamide hydrochloride |
| Molecular Formula | C26H29Cl2N3O2 |
| Molecular Weight | 486.4334 |
| InChl | InChI=1/C26H28ClN3O2.ClH/c1-32-24-17-23(28)22(27)16-21(24)26(31)29-20-12-14-30(15-13-20)25(18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,16-17,20,25H,12-15,28H2,1H3,(H,29,31);1H |
| CAS Registry Number | 57645-77-9 |
| Molecular Structure | ![]() |
| Boiling Point | 579°C at 760 mmHg |
| Flash Point | 304°C |
| Vapour Pressur | 2.1E-13mmHg at 25°C |
| MSDS | |