ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58-61-7 Adenosine |
|
| Chemical Name | Adenosine |
| Synonyms | adenosine free base;6-Amino-9-(beta-D-ribofuranosyl)9H-purine;9-alpha-D-lyxofuranosyl-9H-purin-6-amine;AR |
| Molecular Formula | C10H13N5O4 |
| Molecular Weight | 267.2413 |
| InChl | InChI=1/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6+,7+,10+/m1/s1 |
| CAS Registry Number | 58-61-7 |
| EINECS | 200-389-9 |
| Molecular Structure | ![]() |
| Density | 2.08g/cm3 |
| Melting Point | 234-236℃ |
| Boiling Point | 676.3°C at 760 mmHg |
| Refractive Index | 1.907 |
| Flash Point | 362.8°C |
| Vapour Pressur | 3.26E-19mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |