ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59282-56-3 4-(3-oxobutyl)phenyl 6-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranoside |
|
| Chemical Name | 4-(3-oxobutyl)phenyl 6-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranoside |
| Molecular Formula | C23H26O11 |
| Molecular Weight | 478.4459 |
| InChl | InChI=1/C23H26O11/c1-11(24)2-3-12-4-6-14(7-5-12)33-23-21(30)20(29)19(28)17(34-23)10-32-22(31)13-8-15(25)18(27)16(26)9-13/h4-9,17,19-21,23,25-30H,2-3,10H2,1H3/t17-,19-,20+,21-,23-/m1/s1 |
| CAS Registry Number | 59282-56-3 |
| Molecular Structure | ![]() |
| Density | 1.497g/cm3 |
| Boiling Point | 785.4°C at 760 mmHg |
| Refractive Index | 1.647 |
| Flash Point | 270.1°C |
| Vapour Pressur | 5.54E-26mmHg at 25°C |
| MSDS | |