ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59345-41-4 5-(1-naphthyl)-5-oxo-pentanoic acid |
|
| Chemical Name | 5-(1-naphthyl)-5-oxo-pentanoic acid |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.2699 |
| InChl | InChI=1/C15H14O3/c16-14(9-4-10-15(17)18)13-8-3-6-11-5-1-2-7-12(11)13/h1-3,5-8H,4,9-10H2,(H,17,18) |
| CAS Registry Number | 59345-41-4 |
| Molecular Structure | ![]() |
| Density | 1.216g/cm3 |
| Boiling Point | 477°C at 760 mmHg |
| Refractive Index | 1.615 |
| Flash Point | 256.4°C |
| Vapour Pressur | 6.59E-10mmHg at 25°C |
| MSDS | |