ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59703-00-3 4-Ethyl-2,3-dioxo-1-piperazinecarbonylchloride |
|
| Chemical Name | 4-Ethyl-2,3-dioxo-1-piperazinecarbonylchloride |
| Synonyms | 4-Ethyl-2,3-dioxo-1-piperazine carbonyl chloride;4-ethyl-2,3-dioxopiperazine-1-carbonyl chloride;EDPC |
| Molecular Formula | C7H9ClN2O3 |
| Molecular Weight | 204.611 |
| InChl | InChI=1/C7H9ClN2O3/c1-2-9-3-4-10(7(8)13)6(12)5(9)11/h2-4H2,1H3 |
| CAS Registry Number | 59703-00-3 |
| EINECS | 261-867-0 |
| Molecular Structure | ![]() |
| Density | 1.408g/cm3 |
| Melting Point | 100℃ |
| Boiling Point | 292.9°C at 760 mmHg |
| Refractive Index | 1.525 |
| Flash Point | 131°C |
| Water Solubility | decomposes |
| Vapour Pressur | 0.00178mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R34:; |
| Safety Description | S26||S36/37/39||S45:; |
| MSDS | |