ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
615-35-0 N,N'-Dimethyloxamide |
|
| Chemical Name | N,N'-Dimethyloxamide |
| Synonyms | NN-Dimethyloxamide;N,N-Dimethyloxamide;N,N'-Dimethyloxalamide;N,N'-dimethylethanediamide |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.1185 |
| InChl | InChI=1/C4H8N2O2/c1-5-3(7)4(8)6-2/h1-2H3,(H,5,7)(H,6,8) |
| CAS Registry Number | 615-35-0 |
| EINECS | 210-420-8 |
| Molecular Structure | ![]() |
| Density | 1.091g/cm3 |
| Melting Point | 214-217℃ |
| Refractive Index | 1.436 |
| Safety Description | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |