617-80-1 2-ethylbutyronitrile |
|
| Product Name | 2-ethylbutyronitrile |
| Synonyms | 2-Ethylbutyronitrile;2-ethylbutanenitrile |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.1582 |
| InChl | InChI=1/C6H11N/c1-3-6(4-2)5-7/h6H,3-4H2,1-2H3 |
| CAS Registry Number | 617-80-1 |
| EINECS | 210-531-1 |
| Molecular Structure |  |
| Density | 0.8g/cm3 |
| Boiling Point | 145.5°C at 760 mmHg |
| Refractive Index | 1.404 |
| Flash Point | 46°C |
| Vapour Pressur | 4.85mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
