ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
63524-04-9 sodium D-isoascorbate monohydrate |
|
| Chemical Name | sodium D-isoascorbate monohydrate |
| Synonyms | D(+)-Isoascorbic acid, sodium salt monohydrate;Sodium erythorbate monohydrate;[(5R)-5-(1,2-dihydroxyethyl)-4-hydroxy-5-methyl-2-oxo-3-furyl]oxysodium hydrate |
| Molecular Formula | C7H11NaO7 |
| Molecular Weight | 230.1478 |
| InChl | InChI=1/C7H10O6.Na.H2O/c1-7(3(9)2-8)5(11)4(10)6(12)13-7;;/h3,8-11H,2H2,1H3;;1H2/q;+1;/p-1/t3?,7-;;/m1../s1 |
| CAS Registry Number | 63524-04-9 |
| EINECS | 228-973-9 |
| Molecular Structure | ![]() |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |