ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
700-44-7 6-Methoxysalicylaldehyde |
|
| Chemical Name | 6-Methoxysalicylaldehyde |
| Synonyms | 2-Hydroxy-6-methoxybenzaldehyde;6-Hydroxy-o-anisaldehyde;2-hydroxy-6-methoxy benzaldehyde |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.1473 |
| InChl | InChI=1/C8H8O3/c1-11-8-4-2-3-7(10)6(8)5-9/h2-5,10H,1H3 |
| CAS Registry Number | 700-44-7 |
| EINECS | 211-844-6 |
| Molecular Structure | ![]() |
| Density | 1.231g/cm3 |
| Boiling Point | 262.9°C at 760 mmHg |
| Refractive Index | 1.587 |
| Flash Point | 107.8°C |
| Vapour Pressur | 0.00651mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |