ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72138-87-5 oxydipropane-3,1-diyl bis(4-methylbenzoate) |
|
| Chemical Name | oxydipropane-3,1-diyl bis(4-methylbenzoate) |
| Synonyms | benzoic acid, 4-methyl-, oxydi-3,1-propanediyl ester |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.4388 |
| InChl | InChI=1/C22H26O5/c1-17-5-9-19(10-6-17)21(23)26-15-3-13-25-14-4-16-27-22(24)20-11-7-18(2)8-12-20/h5-12H,3-4,13-16H2,1-2H3 |
| CAS Registry Number | 72138-87-5 |
| Molecular Structure | ![]() |
| Density | 1.118g/cm3 |
| Boiling Point | 498°C at 760 mmHg |
| Refractive Index | 1.54 |
| Flash Point | 215.5°C |
| Vapour Pressur | 4.72E-10mmHg at 25°C |
| MSDS | |