ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77662-89-6 N~6~-[(3-methoxypropoxy)carbonyl]lysine |
|
| Chemical Name | N~6~-[(3-methoxypropoxy)carbonyl]lysine |
| Molecular Formula | C11H22N2O5 |
| Molecular Weight | 262.3028 |
| InChl | InChI=1/C11H22N2O5/c1-17-7-4-8-18-11(16)13-6-3-2-5-9(12)10(14)15/h9H,2-8,12H2,1H3,(H,13,16)(H,14,15) |
| CAS Registry Number | 77662-89-6 |
| Molecular Structure | ![]() |
| Density | 1.153g/cm3 |
| Boiling Point | 455.8°C at 760 mmHg |
| Refractive Index | 1.484 |
| Flash Point | 229.5°C |
| Vapour Pressur | 1.41E-09mmHg at 25°C |
| MSDS | |