ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
78711-79-2 propan-2-yl 2-{4-[(7-chloro-1-oxido-1,2,4-benzotriazin-3-yl)(methyl)amino]phenoxy}propanoate |
|
| Chemical Name | propan-2-yl 2-{4-[(7-chloro-1-oxido-1,2,4-benzotriazin-3-yl)(methyl)amino]phenoxy}propanoate |
| Molecular Formula | C20H21ClN4O4 |
| Molecular Weight | 416.8581 |
| InChl | InChI=1/C20H21ClN4O4/c1-12(2)28-19(26)13(3)29-16-8-6-15(7-9-16)24(4)20-22-17-10-5-14(21)11-18(17)25(27)23-20/h5-13H,1-4H3 |
| CAS Registry Number | 78711-79-2 |
| Molecular Structure | ![]() |
| Density | 1.33g/cm3 |
| Boiling Point | 583.4°C at 760 mmHg |
| Refractive Index | 1.615 |
| Flash Point | 306.6°C |
| Vapour Pressur | 1.34E-13mmHg at 25°C |
| MSDS | |