ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
79220-32-9 N~5~-(diaminomethylidene)ornithylglutamic acid acetate (1:1) |
|
| Chemical Name | N~5~-(diaminomethylidene)ornithylglutamic acid acetate (1:1) |
| Molecular Formula | C13H25N5O7 |
| Molecular Weight | 363.3669 |
| InChl | InChI=1/C11H21N5O5.C2H4O2/c12-6(2-1-5-15-11(13)14)9(19)16-7(10(20)21)3-4-8(17)18;1-2(3)4/h6-7H,1-5,12H2,(H,16,19)(H,17,18)(H,20,21)(H4,13,14,15);1H3,(H,3,4) |
| CAS Registry Number | 79220-32-9 |
| Molecular Structure | ![]() |
| MSDS | |