ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
800-35-1 1-[(Z)-2-bromo-2-(4-fluorophenyl)-1-phenylethenyl]-4-methoxybenzene |
|
| Chemical Name | 1-[(Z)-2-bromo-2-(4-fluorophenyl)-1-phenylethenyl]-4-methoxybenzene |
| Synonyms | Anisole, p-(beta-bromo-p-fluoro-alpha-phenylstyryl)-, (Z)-;cis-1-Bromo-1-(p-fluorophenyl)-2-(p-methoxyphenyl)-2-phenylethylene;Ethylene, 1-bromo-1-(p-fluorophenyl)-2-(p-methoxyphenyl)-2-phenyl-, (Z)-;Stilbene, alpha'-bromo-4'-fluoro-4-methoxy-alpha-phenyl-, (Z)- |
| Molecular Formula | C21H16BrFO |
| Molecular Weight | 383.2535 |
| InChl | InChI=1/C21H16BrFO/c1-24-19-13-9-16(10-14-19)20(15-5-3-2-4-6-15)21(22)17-7-11-18(23)12-8-17/h2-14H,1H3/b21-20- |
| CAS Registry Number | 800-35-1 |
| Molecular Structure | ![]() |
| Density | 1.35g/cm3 |
| Boiling Point | 443.4°C at 760 mmHg |
| Refractive Index | 1.62 |
| Flash Point | 268.7°C |
| Vapour Pressur | 1.22E-07mmHg at 25°C |
| MSDS | |