ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
801-21-8 N'~1~,N'~6~-bis(furan-2-ylmethylidene)hexanedihydrazide |
|
| Chemical Name | N'~1~,N'~6~-bis(furan-2-ylmethylidene)hexanedihydrazide |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.3385 |
| InChl | InChI=1/C16H18N4O4/c21-15(19-17-11-13-5-3-9-23-13)7-1-2-8-16(22)20-18-12-14-6-4-10-24-14/h3-6,9-12H,1-2,7-8H2,(H,19,21)(H,20,22) |
| CAS Registry Number | 801-21-8 |
| Molecular Structure | ![]() |
| Density | 1.27g/cm3 |
| Refractive Index | 1.592 |
| MSDS | |