ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
801-37-6 3-oxopregn-4-ene-21,17-carbolactone |
|
| Chemical Name | 3-oxopregn-4-ene-21,17-carbolactone |
| Synonyms | 3-Oxopregn-4-ene-21,17-carbolactone;(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-1,6,7,8,9,10,11,12,13,14,15,16-dodecahydro-3'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-3,5'(2H,4'H)-dione;10,13-dimethyl-1,6,7,8,9,10,11,12,13,14,15,16-dodecahydro-3'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-3,5'(2H,4'H)-dione |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.4718 |
| InChl | InChI=1/C22H30O3/c1-20-9-5-15(23)13-14(20)3-4-16-17(20)6-10-21(2)18(16)7-11-22(21)12-8-19(24)25-22/h13,16-18H,3-12H2,1-2H3 |
| CAS Registry Number | 801-37-6 |
| EINECS | 212-351-9 |
| Molecular Structure | ![]() |
| Density | 1.17g/cm3 |
| Boiling Point | 522.8°C at 760 mmHg |
| Refractive Index | 1.565 |
| Flash Point | 229°C |
| Vapour Pressur | 5.01E-11mmHg at 25°C |
| MSDS | |