ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
802-51-7 2,5-di(2-naphthyl)-1,3,4-oxadiazole |
|
| Chemical Name | 2,5-di(2-naphthyl)-1,3,4-oxadiazole |
| Synonyms | 2,5-Di(2-naphthyl)-1,3,4-oxadiazole;2,5-di(naphthalen-2-yl)-1,3,4-oxadiazole |
| Molecular Formula | C22H14N2O |
| Molecular Weight | 322.3594 |
| InChl | InChI=1/C22H14N2O/c1-3-7-17-13-19(11-9-15(17)5-1)21-23-24-22(25-21)20-12-10-16-6-2-4-8-18(16)14-20/h1-14H |
| CAS Registry Number | 802-51-7 |
| EINECS | 212-352-4 |
| Molecular Structure | ![]() |
| Density | 1.251g/cm3 |
| Boiling Point | 556.4°C at 760 mmHg |
| Refractive Index | 1.7 |
| Flash Point | 293.1°C |
| Vapour Pressur | 7.55E-12mmHg at 25°C |
| MSDS | |