ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
8047-99-2 N-ethyl-4-methylbenzenesulfonamide |
|
| Chemical Name | N-ethyl-4-methylbenzenesulfonamide |
| Synonyms | N-ethyl-p-toluenesulfonamide;santicizer 8;toluene ethylsulfonamide;N-Ethyl p-Toluene Sulfonamide;N-ethyl-p-toluenesulphonamide;N-E-PTSA;N-Ethyl-p-toluene sulfonamide;N-ethyl-4-methyl-benzenesulfonamide;N-Ethyl-O/P-Toluenesulfonamide;N-Ethyl-2/4-methylbenzenesulfonamide;n-ethyl o/p toluene sulfonamide;2-ethyl-4-methylbenzenesulfonamide;ethanesulfonamide - methylbenzene (1:1);N-Ethyltoluene-4-sulphonamide;N-ethyl-o,p-toluene sulfonamide;N-Ethyl-O,P-Toluenesulfonamide;N-ethyl-o/p-toluene sulfonamide;N-E-O/PTSA;N-ethyl p-toluenesulfonyl amine (N-PTSA) |
| Molecular Formula | C9H12NO2S |
| Molecular Weight | 198.26208 |
| InChl | InChI=1/C9H13NO2S/c1-3-8-6-7(2)4-5-9(8)10-13(11)12/h4-6,13H,3H2,1-2H3,(H,10,11,12) |
| CAS Registry Number | 8047-99-2;1321-54-6;80-39-7 |
| EINECS | 232-465-2 |
| Molecular Structure | ![]() |
| Melting Point | 63-65℃ |
| Water Solubility | <0.01 g/100 mL at 18℃ |
| Hazard Symbols | |
| Risk Codes | R36/37/38:; |
| Safety Description | S26||S36/37:; |
| MSDS | |