ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
808-24-2 nicodicodine |
|
| Chemical Name | nicodicodine |
| Synonyms | 7,8-dihydro-6-O-nicotinoylcodeine;3-methoxy-N-methyl-4,5-epoxymorphinan-6-yl nicotinate;(5alpha,6alpha)-3-methoxy-17-methyl-4,5-epoxymorphinan-6-yl pyridine-3-carboxylate |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.4742 |
| InChl | InChI=1/C24H26N2O4/c1-26-11-9-24-16-6-8-19(29-23(27)15-4-3-10-25-13-15)22(24)30-21-18(28-2)7-5-14(20(21)24)12-17(16)26/h3-5,7,10,13,16-17,19,22H,6,8-9,11-12H2,1-2H3/t16-,17+,19-,22-,24-/m0/s1 |
| CAS Registry Number | 808-24-2 |
| EINECS | 212-365-5 |
| Molecular Structure | ![]() |
| Density | 1.34g/cm3 |
| Boiling Point | 553.3°C at 760 mmHg |
| Refractive Index | 1.649 |
| Flash Point | 288.4°C |
| Vapour Pressur | 2.75E-12mmHg at 25°C |
| MSDS | |