ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81-83-4 1,8-Naphthalimide |
|
| Chemical Name | 1,8-Naphthalimide |
| Synonyms | naphthalene-1,8-dicarboximide;1H-benzo[de]isoquinoline-1,3(2H)-dione;naphthalene-1,8-dicarboxamide |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 |
| InChl | InChI=1/C12H10N2O2/c13-11(15)8-5-1-3-7-4-2-6-9(10(7)8)12(14)16/h1-6H,(H2,13,15)(H2,14,16) |
| CAS Registry Number | 81-83-4 |
| EINECS | 201-379-7 |
| Molecular Structure | ![]() |
| Density | 1.33g/cm3 |
| Melting Point | 299-300℃ |
| Boiling Point | 577.7°C at 760 mmHg |
| Refractive Index | 1.696 |
| Flash Point | 303.2°C |
| Vapour Pressur | 2.41E-13mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R36:; |
| Safety Description | S26||S37/39:; |
| MSDS | |