ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
815-59-8 2-fluoropropanediamide |
|
| Chemical Name | 2-fluoropropanediamide |
| Molecular Formula | C3H5FN2O2 |
| Molecular Weight | 120.0824 |
| InChl | InChI=1/C3H5FN2O2/c4-1(2(5)7)3(6)8/h1H,(H2,5,7)(H2,6,8) |
| CAS Registry Number | 815-59-8 |
| Molecular Structure | ![]() |
| Density | 1.404g/cm3 |
| Boiling Point | 475.1°C at 760 mmHg |
| Refractive Index | 1.455 |
| Flash Point | 241.2°C |
| Vapour Pressur | 3.41E-09mmHg at 25°C |
| MSDS | |