ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
815-84-9 Lead(II) tartrate |
|
| Chemical Name | Lead(II) tartrate |
| Synonyms | L(+)tartaric acid lead;Leadtartrate;lead(2+) 2,3-dihydroxybutanedioate |
| Molecular Formula | C4H4O6Pb |
| Molecular Weight | 355.271 |
| InChl | InChI=1/C4H6O6.Pb/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2 |
| CAS Registry Number | 815-84-9 |
| EINECS | 212-426-6 |
| Molecular Structure | ![]() |
| Boiling Point | 399.3°C at 760 mmHg |
| Flash Point | 209.4°C |
| Vapour Pressur | 4.93E-08mmHg at 25°C |
| MSDS | |