ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-03-1 2-methyl-7H-benzo[de]anthracen-7-one |
|
| Chemical Name | 2-methyl-7H-benzo[de]anthracen-7-one |
| Synonyms | 7H-Benz[de]anthracen-7-one, 2-methyl- |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.2873 |
| InChl | InChI=1/C18H12O/c1-11-9-12-5-4-8-15-17(12)16(10-11)13-6-2-3-7-14(13)18(15)19/h2-10H,1H3 |
| CAS Registry Number | 82-03-1 |
| Molecular Structure | ![]() |
| Density | 1.251g/cm3 |
| Boiling Point | 448.2°C at 760 mmHg |
| Refractive Index | 1.713 |
| Flash Point | 200.8°C |
| Vapour Pressur | 3.16E-08mmHg at 25°C |
| MSDS | |