ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-07-5 Xanthene-9-carboxylic acid |
|
| Chemical Name | Xanthene-9-carboxylic acid |
| Synonyms | xanthoic acid;Methyl xanthene-9-carboxylate;9-Xanthene carboxylic acid;Xomthene-9-carboxylic methylester acid;9H-xanthene-9-carboxylic acid;9H-xanthene-9-carboxylate |
| Molecular Formula | C14H9O3 |
| Molecular Weight | 225.22 |
| InChl | InChI=1/C14H10O3/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13/h1-8,13H,(H,15,16)/p-1 |
| CAS Registry Number | 82-07-5 |
| EINECS | 201-394-9 |
| Molecular Structure | ![]() |
| Melting Point | 221-225℃ |
| Boiling Point | 391.3°C at 760 mmHg |
| Flash Point | 153.1°C |
| Vapour Pressur | 7.99E-07mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |