ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-43-9 1,8-Dichloroanthraquinone |
|
| Chemical Name | 1,8-Dichloroanthraquinone |
| Synonyms | 1,8-dichloroanthracene-9,10-dione;1,8-Dichloro Antrhaquinone |
| Molecular Formula | C14H6Cl2O2 |
| Molecular Weight | 277.1022 |
| InChl | InChI=1/C14H6Cl2O2/c15-9-5-1-3-7-11(9)14(18)12-8(13(7)17)4-2-6-10(12)16/h1-6H |
| CAS Registry Number | 82-43-9 |
| EINECS | 201-420-9 |
| Molecular Structure | ![]() |
| Density | 1.514g/cm3 |
| Boiling Point | 455.2°C at 760 mmHg |
| Refractive Index | 1.671 |
| Flash Point | 191.7°C |
| Vapour Pressur | 1.79E-08mmHg at 25°C |
| MSDS | |