ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-72-7 2-Hydroxy-p-naphthoquinone |
|
| Chemical Name | 2-Hydroxy-p-naphthoquinone |
| Synonyms | C.I. Natural Orange 6;Henna;C.I. 75480;Lawsone2-hydroxy-1,4-naphthoquinone;Natural Orange 6;Lawsone;2-Hydroxy-1,4-Naphthquinone;2-Hydroxy-1,4-naphthoquinone;2-Hydroxy-1,4-Naphoquinone |
| Molecular Formula | C10H6O3 |
| Molecular Weight | 174.15 |
| InChl | InChI=1/C10H6O3/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5,12H |
| CAS Registry Number | 83-72-7 |
| EINECS | 201-496-3 |
| Molecular Structure | ![]() |
| Melting Point | 192-195℃ |
| Water Solubility | 2 g/L (20℃) |
| Hazard Symbols | |
| Risk Codes | R22||R36||R68:; |
| Safety Description | S26||S36/37/39:; |
| MSDS | |