ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
845266-25-3 4-(2,1,3-benzoxadiazol-5-ylmethoxy)benzonitrile |
|
| Chemical Name | 4-(2,1,3-benzoxadiazol-5-ylmethoxy)benzonitrile |
| Molecular Formula | C14H9N3O2 |
| Molecular Weight | 251.2402 |
| InChl | InChI=1/C14H9N3O2/c15-8-10-1-4-12(5-2-10)18-9-11-3-6-13-14(7-11)17-19-16-13/h1-7H,9H2 |
| CAS Registry Number | 845266-25-3 |
| Molecular Structure | ![]() |
| Density | 1.36g/cm3 |
| Boiling Point | 450.9°C at 760 mmHg |
| Refractive Index | 1.659 |
| Flash Point | 226.5°C |
| Vapour Pressur | 2.53E-08mmHg at 25°C |
| MSDS | |