84605-05-0 1-(1H-indol-3-yl)-N-methyl-N-nitrosomethanamine |
|
| Product Name | 1-(1H-indol-3-yl)-N-methyl-N-nitrosomethanamine |
| Synonyms | 1H-Indole-3-methanamine, N-methyl-N-nitroso- |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.2138 |
| InChl | InChI=1/C10H11N3O/c1-13(12-14)7-8-6-11-10-5-3-2-4-9(8)10/h2-6,11H,7H2,1H3 |
| CAS Registry Number | 84605-05-0 |
| Molecular Structure |  |
| Density | 1.23g/cm3 |
| Boiling Point | 445.5°C at 760 mmHg |
| Refractive Index | 1.626 |
| Flash Point | 223.2°C |
| Vapour Pressur | 1.03E-07mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
