ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-40-5 1,2,3,6-tetrahydrophthalimide |
|
| Chemical Name | 1,2,3,6-tetrahydrophthalimide |
| Synonyms | 4-Cyclohexene-1,2-dicarboximide;Tetrahydrophthalimide;1H-Isoindole-1,3(2H)-dione,3a,4,7,7a-tetrahydro-;Isoindole-1,3-dione, 3a,4,7,7a-tetrahydro-;Tetrahydrophthalic acid imide;delta(4)-Tetrahydrophthalimide;delta(sup 4)-Tetrahydrophthalimide;cis-1,2,3,6-Tetrahydrophthalimide;3a,4,7,7a-tetrahydro-1H-isoindole-1,3(2H)-dione;(3aR,7aS)-3a,4,7,7a-tetrahydro-1H-isoindole-1,3(2H)-dione;3,4,5,6-Tetrahydrophthalimide;Phthalimide, tetrahydro-;1H-Isoindole-1,3(2H)-dione, tetrahydro-;Cyclohexene-1,2-dicarboximide;4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione;4,5,6,7-Tetrahydroisoindole-1,3-dione |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.1626 |
| InChl | InChI=1/C8H9NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-2,5-6H,3-4H2,(H,9,10,11)/t5-,6+ |
| CAS Registry Number | 85-40-5;1469-48-3;27813-21-4 |
| EINECS | 201-602-8;215-999-0;248-667-9 |
| Molecular Structure | ![]() |
| Density | 1.228g/cm3 |
| Melting Point | 132-140℃ |
| Boiling Point | 336.8°C at 760 mmHg |
| Refractive Index | 1.532 |
| Flash Point | 165°C |
| Vapour Pressur | 0.00011mmHg at 25°C |
| MSDS | |