ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-41-6 Phthalimide |
|
| Chemical Name | Phthalimide |
| Synonyms | 2,5-Isoindoledione;PHTALIMIDE;Benzene-1,2-dicarboxylic acid imide;Isoindole-1,3-dione;o-Phthalimide;LABOTEST-BB LTBB000782;1,2-PHTHALIC IMIDE;1,2-BENZENEDICARBOXIMIDE;1,3-DIHYDROISOINDOLE-1,3-DIONE;1,3-ISOINDOLEDIONE;1H-ISOINDOLE-1,3(2H)-DIONE;O-PHTHALIC IMIDE;2-Phthalimide;Antiscorching Agent YG-1 |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.13 |
| InChl | InChI=1/C8H5NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-4H,(H,9,10,11) |
| CAS Registry Number | 85-41-6 |
| EINECS | 201-603-3 |
| Molecular Structure | ![]() |
| Melting Point | 233.5-235℃ |
| Boiling Point | 366℃ |
| Flash Point | 165℃ |
| Water Solubility | <0.1 g/100 mL at 19.5℃ |
| Safety Description | S24/25:; |
| MSDS | |