ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85029-64-7 methyl octadecadienoate, compound with succinic anhydride (1:1) |
|
Chemical Name | methyl octadecadienoate, compound with succinic anhydride (1:1) |
Synonyms | Methyl octadecadienoate, compound with succinic anhydride (1:1);methyl octadeca-2,4-dienoate; tetrahydrofuran-2,5-dione |
Molecular Formula | C23H38O5 |
Molecular Weight | 394.5448 |
InChl | InChI=1/C19H34O2.C4H4O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2;5-3-1-2-4(6)7-3/h15-18H,3-14H2,1-2H3;1-2H2 |
CAS Registry Number | 85029-64-7 |
EINECS | 285-090-1 |
Molecular Structure | ![]() |
Boiling Point | 520.3°C at 760 mmHg |
Flash Point | 221.3°C |
Vapour Pressur | 6.29E-11mmHg at 25°C |
MSDS |