ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
855222-19-4 4-hydroxy-2-(4-methoxyphenyl)butanenitrile |
|
| Chemical Name | 4-hydroxy-2-(4-methoxyphenyl)butanenitrile |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.2264 |
| InChl | InChI=1/C11H13NO2/c1-14-11-4-2-9(3-5-11)10(8-12)6-7-13/h2-5,10,13H,6-7H2,1H3 |
| CAS Registry Number | 855222-19-4 |
| Molecular Structure | ![]() |
| Density | 1.118g/cm3 |
| Boiling Point | 369.3°C at 760 mmHg |
| Refractive Index | 1.534 |
| Flash Point | 177.1°C |
| Vapour Pressur | 4.19E-06mmHg at 25°C |
| MSDS | |