ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-30-6 N-nitrosodiphenylamine |
|
| Chemical Name | N-nitrosodiphenylamine |
| Synonyms | Diphenylnitrosamine; N-Nitroso-N-phenylbenzenamine |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.2365 |
| InChl | InChI=1/C12H10.H2N2O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3/h1-10H;(H2,1,3) |
| CAS Registry Number | 86-30-6 |
| EINECS | 201-663-0 |
| Molecular Structure | ![]() |
| Melting Point | 66.5℃ |
| Water Solubility | Insoluble |
| MSDS | |