ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-66-1 Pyrogallol |
|
| Chemical Name | Pyrogallol |
| Synonyms | C.I. 76515;C.I. Oxidation Base 32;Pyrogallol [NF X];1,2,3-Benzenetriol;1,2,3-Trihydroxybenzene;Pyrogallic acid~1,2,3-Trihydroxybenzene;Pyrogallol solution;1,2,3-Trihydroxybenene;Pyrogallic acid |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 |
| InChl | InChI=1/C6H6O3/c7-4-2-1-3-5(8)6(4)9/h1-3,7-9H |
| CAS Registry Number | 87-66-1 |
| EINECS | 201-762-9 |
| Molecular Structure | ![]() |
| Density | 1.453 |
| Melting Point | 131-135℃ |
| Boiling Point | 309℃ |
| Water Solubility | 400 g/L (25℃) |
| Hazard Symbols | |
| Risk Codes | R20/21/22||R52/53||R68:; |
| Safety Description | S36/37||S61:; |
| MSDS | |