ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-71-8 4-({(1R,2R,3R)-3-hydroxy-2-[(1E,3S,5S)-3-hydroxy-5-methylnon-1-en-1-yl]-5-oxocyclopentyl}acetyl)cyclohexanecarboxylic acid |
|
| Chemical Name | 4-({(1R,2R,3R)-3-hydroxy-2-[(1E,3S,5S)-3-hydroxy-5-methylnon-1-en-1-yl]-5-oxocyclopentyl}acetyl)cyclohexanecarboxylic acid |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.5549 |
| InChl | InChI=1/C24H38O6/c1-3-4-5-15(2)12-18(25)10-11-19-20(23(28)14-22(19)27)13-21(26)16-6-8-17(9-7-16)24(29)30/h10-11,15-20,22,25,27H,3-9,12-14H2,1-2H3,(H,29,30)/b11-10+/t15-,16?,17?,18+,19+,20+,22+/m0/s1 |
| CAS Registry Number | 87-71-8 |
| Molecular Structure | ![]() |
| Density | 1.18g/cm3 |
| Boiling Point | 603.1°C at 760 mmHg |
| Refractive Index | 1.558 |
| Flash Point | 332.5°C |
| Vapour Pressur | 4.63E-17mmHg at 25°C |
| MSDS | |