ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-14-2 2-Furoic acid |
|
| Chemical Name | 2-Furoic acid |
| Synonyms | Furan-2-carboxylic acid;pyromucic acid;furan-2-carboxylate;2-Furancarbosylicacid |
| Molecular Formula | C5H4O3 |
| Molecular Weight | 112.0835 |
| InChl | InChI=1/C5H4O3/c6-5(7)4-2-1-3-8-4/h1-3H,(H,6,7) |
| CAS Registry Number | 88-14-2;26447-28-9 |
| EINECS | 201-803-0;247-713-5 |
| Molecular Structure | ![]() |
| Density | 1.322g/cm3 |
| Melting Point | 129-133℃ |
| Boiling Point | 232.14°C at 760 mmHg |
| Refractive Index | 1.513 |
| Flash Point | 94.195°C |
| Water Solubility | 36 g/L (20℃) |
| Vapour Pressur | 0.033mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R34||R36/37/38:; |
| Safety Description | S26||S36/37/39||S45:; |
| MSDS | |