ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88-82-4 2,3,5-Triiodobenzoic acid |
|
| Chemical Name | 2,3,5-Triiodobenzoic acid |
| Synonyms | Triiodobenzoicacid,98%;2,3,5-triiodobenzoate |
| Molecular Formula | C7H2I3O2 |
| Molecular Weight | 498.8035 |
| InChl | InChI=1/C7H3I3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H,11,12)/p-1 |
| CAS Registry Number | 88-82-4 |
| EINECS | 201-859-6 |
| Molecular Structure | ![]() |
| Melting Point | 220-222℃ |
| Boiling Point | 456.7°C at 760 mmHg |
| Flash Point | 230°C |
| Vapour Pressur | 3.92E-09mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R22:; |
| Safety Description | S24/25:; |
| MSDS | |