ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
885519-93-7 4-hydroxy-1H-indazole-3-carboxylic acid |
|
| Chemical Name | 4-hydroxy-1H-indazole-3-carboxylic acid |
| Synonyms | 1H-indazole-3-carboxylic acid, 4-hydroxy- |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.1448 |
| InChl | InChI=1/C8H6N2O3/c11-5-3-1-2-4-6(5)7(8(12)13)10-9-4/h1-3,11H,(H,9,10)(H,12,13) |
| CAS Registry Number | 885519-93-7 |
| Molecular Structure | ![]() |
| Density | 1.679g/cm3 |
| Boiling Point | 541.2°C at 760 mmHg |
| Refractive Index | 1.802 |
| Flash Point | 281.1°C |
| Vapour Pressur | 1.52E-12mmHg at 25°C |
| MSDS | |