ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-09-8 4,4'-methylenebis[N,N-dimethyl-2-nitroaniline] |
|
| Chemical Name | 4,4'-methylenebis[N,N-dimethyl-2-nitroaniline] |
| Synonyms | 4,4'-Methylenebis(N,N-dimethyl-2-nitroaniline);4,4'-methanediylbis(N,N-dimethyl-2-nitroaniline) |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.3651 |
| InChl | InChI=1/C17H20N4O4/c1-18(2)14-7-5-12(10-16(14)20(22)23)9-13-6-8-15(19(3)4)17(11-13)21(24)25/h5-8,10-11H,9H2,1-4H3 |
| CAS Registry Number | 89-09-8 |
| EINECS | 201-882-1 |
| Molecular Structure | ![]() |
| Density | 1.282g/cm3 |
| Boiling Point | 526.3°C at 760 mmHg |
| Refractive Index | 1.644 |
| Flash Point | 272.1°C |
| Vapour Pressur | 3.63E-11mmHg at 25°C |
| MSDS | |