ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-23-6 3-(4-hydroxyphenyl)-2-phenylpropionic acid |
|
| Chemical Name | 3-(4-hydroxyphenyl)-2-phenylpropionic acid |
| Synonyms | 3-(4-Hydroxyphenyl)-2-phenylpropionic acid;3-(p-Hydroxyphenyl)-2-phenylpropionic acid;NSC 60596;alpha-Phenyl-beta-p-hydroxyphenyl propionic acid;Benzenepropanoic acid, 4-hydroxy-alpha-phenyl- (9CI);Propionic acid, 3-(p-hydroxyphenyl)-2-phenyl- (8CI);3-(4-hydroxyphenyl)-2-phenylpropanoic acid;(2S)-3-(4-hydroxyphenyl)-2-phenylpropanoic acid |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.2699 |
| InChl | InChI=1/C15H14O3/c16-13-8-6-11(7-9-13)10-14(15(17)18)12-4-2-1-3-5-12/h1-9,14,16H,10H2,(H,17,18)/t14-/m0/s1 |
| CAS Registry Number | 89-23-6 |
| EINECS | 201-888-4 |
| Molecular Structure | ![]() |
| Density | 1.253g/cm3 |
| Boiling Point | 401.2°C at 760 mmHg |
| Refractive Index | 1.625 |
| Flash Point | 210.6°C |
| Vapour Pressur | 3.7E-07mmHg at 25°C |
| MSDS | |