ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-92-9 alpha-Bromo-o-xylene |
|
| Chemical Name | alpha-Bromo-o-xylene |
| Synonyms | 1-(bromomethyl)-2-methyl-benzen;2-Xylyl bromide;2-xylylbromide;alpha-Bromo-ortho-xylene;alpha-bromo-o-xylen;o-xylene, alpha-bromo-;O-(bromomethyl)toluene;O-xylene Bis(TRIPHENYLPHOSPONIUM bromide);2-Methylbenzyl bromide;α-Bromo-o-xylene |
| Molecular Formula | C8H9Br |
| Molecular Weight | 185.06 |
| InChl | InChI=1/C8H9Br/c1-7-4-2-3-5-8(7)6-9/h2-5H,6H2,1H3 |
| CAS Registry Number | 89-92-9 |
| EINECS | 201-951-6 |
| Molecular Structure | ![]() |
| Density | 1.38 |
| Melting Point | 16-18℃ |
| Boiling Point | 216-217℃ (742 mmHg) |
| Refractive Index | 1.574-1.576 |
| Flash Point | 82℃ |
| Water Solubility | practically insoluble |
| Hazard Symbols | |
| Risk Codes | R20/21/22||R34:; |
| Safety Description | S26||S36/37/39||S45:; |
| MSDS | |