ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-98-5 2-Chlorobenzaldehyde |
|
| Chemical Name | 2-Chlorobenzaldehyde |
| Synonyms | 2 chloro benzaldehyde;O-chlorobenzenecarboxyaldehyde;ortho-chlorobenzaldehyde;OCAD;O-CHLOROBENZALDEHYDE;Chlorobenzaldehyde, 2- |
| Molecular Formula | C7H5ClO |
| Molecular Weight | 140.567 |
| InChl | InChI=1/C7H5ClO/c8-7-4-2-1-3-6(7)5-9/h1-5H |
| CAS Registry Number | 89-98-5 |
| EINECS | 201-956-3 |
| Molecular Structure | ![]() |
| Density | 1.243g/cm3 |
| Melting Point | 10-11.5℃ |
| Boiling Point | 211.9°C at 760 mmHg |
| Refractive Index | 1.585 |
| Flash Point | 85°C |
| Water Solubility | 0.1-0.5 g/100 mL at 24℃ |
| Vapour Pressur | 0.178mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R34:; |
| Safety Description | S26||S45:; |
| MSDS | |