ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
898769-78-3 4-[4-(morpholinomethyl)benzoyl]benzonitrile |
|
| Chemical Name | 4-[4-(morpholinomethyl)benzoyl]benzonitrile |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.3584 |
| InChl | InChI=1/C19H18N2O2/c20-13-15-1-5-17(6-2-15)19(22)18-7-3-16(4-8-18)14-21-9-11-23-12-10-21/h1-8H,9-12,14H2 |
| CAS Registry Number | 898769-78-3 |
| Molecular Structure | ![]() |
| Density | 1.23g/cm3 |
| Boiling Point | 487°C at 760 mmHg |
| Refractive Index | 1.622 |
| Flash Point | 248.3°C |
| Vapour Pressur | 1.23E-09mmHg at 25°C |
| MSDS | |