ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
900806-58-8 2,7-diphenylbenzothiopheno[3,2-b]benzothiophene |
|
| Chemical Name | 2,7-diphenylbenzothiopheno[3,2-b]benzothiophene |
| Synonyms | [1]benzothieno[3,2-b][1]benzothiophene, 2,7-diphenyl-;2,7-Diphenyl[1]benzothieno[3,2-b][1]benzothiophene |
| Molecular Formula | C26H16S2 |
| Molecular Weight | 392.5352 |
| InChl | InChI=1/C26H16S2/c1-3-7-17(8-4-1)19-11-13-21-23(15-19)27-26-22-14-12-20(16-24(22)28-25(21)26)18-9-5-2-6-10-18/h1-16H |
| CAS Registry Number | 900806-58-8 |
| Molecular Structure | ![]() |
| Density | 1.303g/cm3 |
| Boiling Point | 632.292°C at 760 mmHg |
| Refractive Index | 1.774 |
| Flash Point | 256.789°C |
| Vapour Pressur | 0mmHg at 25°C |
| MSDS | |